C17H22FN3O2 — CID 119041162
N-(2-cyanoethyl)-N-ethyl-2-[2-(4-fluorophenyl)morpholin-4-yl]acetamide (PubChem CID 119041162) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-ethyl-2-[2-(4-fluorophenyl)morpholin-4-yl]acetamide.
| Compound Name | N-(2-cyanoethyl)-N-ethyl-2-[2-(4-fluorophenyl)morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 119041162 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(2-cyanoethyl)-N-ethyl-2-[2-(4-fluorophenyl)morpholin-4-yl]acetamide |
| SMILES | CCN(CCC#N)C(=O)CN1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H22FN3O2/c1-2-21(9-3-8-19)17(22)13-20-10-11-23-16(12-20)14-4-6-15(18)7-5-14/h4-7,16H,2-3,9-13H2,1H3 |
| InChIKey | STSXOAPUCCMNAD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |