C15H19N3O2 — CID 36735412
N-(2-cyanoethyl)-2-[(2S)-2-phenylmorpholin-4-yl]acetamide (PubChem CID 36735412) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[(2S)-2-phenylmorpholin-4-yl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[(2S)-2-phenylmorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 36735412 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(2-cyanoethyl)-2-[(2S)-2-phenylmorpholin-4-yl]acetamide |
| SMILES | N#CCCNC(=O)CN1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C15H19N3O2/c16-7-4-8-17-15(19)12-18-9-10-20-14(11-18)13-5-2-1-3-6-13/h1-3,5-6,14H,4,8-12H2,(H,17,19)/t14-/m1/s1 |
| InChIKey | PBEATINQWQMHIN-CQSZACIVSA-N |
| XLogP | 1.09 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|