C17H18Cl2N2O2S — CID 87018501
2-[2-(4-chlorophenyl)morpholin-4-yl]-N-[(5-chlorothiophen-2-yl)methyl]acetamide (PubChem CID 87018501) has the molecular formula C17H18Cl2N2O2S and a molecular weight of 385.32 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)morpholin-4-yl]-N-[(5-chlorothiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]-N-[(5-chlorothiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 87018501 |
| Molecular Formula | C17H18Cl2N2O2S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]-N-[(5-chlorothiophen-2-yl)methyl]acetamide |
| SMILES | O=C(CN1CCOC(c2ccc(Cl)cc2)C1)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C17H18Cl2N2O2S/c18-13-3-1-12(2-4-13)15-10-21(7-8-23-15)11-17(22)20-9-14-5-6-16(19)24-14/h1-6,15H,7-11H2,(H,20,22) |
| InChIKey | FNSCONYMFHFSNM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |