C17H18Cl2N2O3 — CID 95175805
2-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 95175805) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is 2-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 95175805 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CN1CCO[C@@H](c2ccc(Cl)c(Cl)c2)C1)NCc1ccco1 |
| InChI | InChI=1S/C17H18Cl2N2O3/c18-14-4-3-12(8-15(14)19)16-10-21(5-7-24-16)11-17(22)20-9-13-2-1-6-23-13/h1-4,6,8,16H,5,7,9-11H2,(H,20,22)/t16-/m1/s1 |
| InChIKey | BBODLHQWKXGNKL-MRXNPFEDSA-N |
| XLogP | 3.28 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |