C18H20ClN3O4 — CID 55827797
2-[2-(4-chlorophenyl)morpholin-4-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide (PubChem CID 55827797) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)morpholin-4-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55827797 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| SMILES | O=C(CN1CCOC(c2ccc(Cl)cc2)C1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H20ClN3O4/c19-14-5-3-13(4-6-14)16-11-22(7-9-26-16)12-17(23)21-18(24)20-10-15-2-1-8-25-15/h1-6,8,16H,7,9-12H2,(H2,20,21,23,24) |
| InChIKey | OQCXNSIGYRPMSV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |