C20H22N6O3 — CID 119044040
N'-methyl-N-(2-methyl-1,3-benzoxazol-5-yl)-N'-(1-pyridazin-3-ylpiperidin-3-yl)oxamide (PubChem CID 119044040) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is N'-methyl-N-(2-methyl-1,3-benzoxazol-5-yl)-N'-(1-pyridazin-3-ylpiperidin-3-yl)oxamide.
| Compound Name | N'-methyl-N-(2-methyl-1,3-benzoxazol-5-yl)-N'-(1-pyridazin-3-ylpiperidin-3-yl)oxamide |
|---|---|
| PubChem CID | 119044040 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N'-methyl-N-(2-methyl-1,3-benzoxazol-5-yl)-N'-(1-pyridazin-3-ylpiperidin-3-yl)oxamide |
| SMILES | Cc1nc2cc(NC(=O)C(=O)N(C)C3CCCN(c4cccnn4)C3)ccc2o1 |
| InChI | InChI=1S/C20H22N6O3/c1-13-22-16-11-14(7-8-17(16)29-13)23-19(27)20(28)25(2)15-5-4-10-26(12-15)18-6-3-9-21-24-18/h3,6-9,11,15H,4-5,10,12H2,1-2H3,(H,23,27) |
| InChIKey | CHRGTGJZGMLHFV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|