C19H22F2N4O3 — CID 119045852
2-(difluoromethoxy)-4-methoxy-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]benzamide (PubChem CID 119045852) has the molecular formula C19H22F2N4O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-(difluoromethoxy)-4-methoxy-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-4-methoxy-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 119045852 |
| Molecular Formula | C19H22F2N4O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-(difluoromethoxy)-4-methoxy-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCN(C)CC3)cn2)c(OC(F)F)c1 |
| InChI | InChI=1S/C19H22F2N4O3/c1-24-7-9-25(10-8-24)13-3-6-17(22-12-13)23-18(26)15-5-4-14(27-2)11-16(15)28-19(20)21/h3-6,11-12,19H,7-10H2,1-2H3,(H,22,23,26) |
| InChIKey | HRBSYEOVJKFQBF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |