C18H24FN3O — CID 119047886
1-(4-fluorophenyl)-2-[[6-[methyl(propan-2-yl)amino]-3-pyridinyl]methylamino]ethanol (PubChem CID 119047886) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[[6-[methyl(propan-2-yl)amino]-3-pyridinyl]methylamino]ethanol.
| Compound Name | 1-(4-fluorophenyl)-2-[[6-[methyl(propan-2-yl)amino]-3-pyridinyl]methylamino]ethanol |
|---|---|
| PubChem CID | 119047886 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[[6-[methyl(propan-2-yl)amino]-3-pyridinyl]methylamino]ethanol |
| SMILES | CC(C)N(C)c1ccc(CNCC(O)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C18H24FN3O/c1-13(2)22(3)18-9-4-14(11-21-18)10-20-12-17(23)15-5-7-16(19)8-6-15/h4-9,11,13,17,20,23H,10,12H2,1-3H3 |
| InChIKey | IQQYOUGYICMWIG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |