C14H16FN3O — CID 62848099
1-(4-fluorophenyl)-2-[(5-methylpyrazin-2-yl)methylamino]ethanol (PubChem CID 62848099) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[(5-methylpyrazin-2-yl)methylamino]ethanol.
| Compound Name | 1-(4-fluorophenyl)-2-[(5-methylpyrazin-2-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 62848099 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[(5-methylpyrazin-2-yl)methylamino]ethanol |
| SMILES | Cc1cnc(CNCC(O)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C14H16FN3O/c1-10-6-18-13(8-17-10)7-16-9-14(19)11-2-4-12(15)5-3-11/h2-6,8,14,16,19H,7,9H2,1H3 |
| InChIKey | JQDYIIUBTXCEQC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |