C19H25NO3 — CID 119048266
N-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(oxan-4-yl)propanamide (PubChem CID 119048266) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(oxan-4-yl)propanamide.
| Compound Name | N-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 119048266 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(oxan-4-yl)propanamide |
| SMILES | Cc1c([C@@H](C)NC(=O)CCC2CCOCC2)oc2ccccc12 |
| InChI | InChI=1S/C19H25NO3/c1-13-16-5-3-4-6-17(16)23-19(13)14(2)20-18(21)8-7-15-9-11-22-12-10-15/h3-6,14-15H,7-12H2,1-2H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | PLXJOTAJXBTXHB-CQSZACIVSA-N |
| XLogP | 4.13 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |