C18H21NO4S — CID 119048571
4-ethyl-N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]benzamide (PubChem CID 119048571) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-ethyl-N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]benzamide.
| Compound Name | 4-ethyl-N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 119048571 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-ethyl-N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]benzamide |
| SMILES | CCc1ccc(C(=O)NCc2ccc(S(=O)(=O)CCO)cc2)cc1 |
| InChI | InChI=1S/C18H21NO4S/c1-2-14-3-7-16(8-4-14)18(21)19-13-15-5-9-17(10-6-15)24(22,23)12-11-20/h3-10,20H,2,11-13H2,1H3,(H,19,21) |
| InChIKey | JBPOGZAXSFMQBF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |