C14H15ClN2O4S — CID 119048587
4-chloro-N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 119048587) has the molecular formula C14H15ClN2O4S and a molecular weight of 342.80 g/mol. Its IUPAC name is 4-chloro-N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 119048587 |
| Molecular Formula | C14H15ClN2O4S |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 4-chloro-N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)CCO)cc1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C14H15ClN2O4S/c15-11-7-13(16-9-11)14(19)17-8-10-1-3-12(4-2-10)22(20,21)6-5-18/h1-4,7,9,16,18H,5-6,8H2,(H,17,19) |
| InChIKey | PHPUORXHDARETC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |