C12H14N4O3S — CID 43642870
4-amino-N-[(4-sulfamoylphenyl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 43642870) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-amino-N-[(4-sulfamoylphenyl)methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[(4-sulfamoylphenyl)methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43642870 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-amino-N-[(4-sulfamoylphenyl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | Nc1c[nH]c(C(=O)NCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C12H14N4O3S/c13-9-5-11(15-7-9)12(17)16-6-8-1-3-10(4-2-8)20(14,18)19/h1-5,7,15H,6,13H2,(H,16,17)(H2,14,18,19) |
| InChIKey | QVPOGVAAHCZBCF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |