C17H14FN3O4S — CID 74232223
8-fluoro-4-oxo-N-[(4-sulfamoylphenyl)methyl]-1H-quinoline-2-carboxamide (PubChem CID 74232223) has the molecular formula C17H14FN3O4S and a molecular weight of 375.38 g/mol. Its IUPAC name is 8-fluoro-4-oxo-N-[(4-sulfamoylphenyl)methyl]-1H-quinoline-2-carboxamide.
| Compound Name | 8-fluoro-4-oxo-N-[(4-sulfamoylphenyl)methyl]-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 74232223 |
| Molecular Formula | C17H14FN3O4S |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 8-fluoro-4-oxo-N-[(4-sulfamoylphenyl)methyl]-1H-quinoline-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cc(=O)c3cccc(F)c3[nH]2)cc1 |
| InChI | InChI=1S/C17H14FN3O4S/c18-13-3-1-2-12-15(22)8-14(21-16(12)13)17(23)20-9-10-4-6-11(7-5-10)26(19,24)25/h1-8H,9H2,(H,20,23)(H,21,22)(H2,19,24,25) |
| InChIKey | NMSOPQLRCQIEBA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |