C15H17F3N4O3 — CID 119049065
1-(1-cyclopropyl-5-oxopyrrolidin-3-yl)-3-[4-methoxy-6-(trifluoromethyl)-3-pyridinyl]urea (PubChem CID 119049065) has the molecular formula C15H17F3N4O3 and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-(1-cyclopropyl-5-oxopyrrolidin-3-yl)-3-[4-methoxy-6-(trifluoromethyl)-3-pyridinyl]urea.
| Compound Name | 1-(1-cyclopropyl-5-oxopyrrolidin-3-yl)-3-[4-methoxy-6-(trifluoromethyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 119049065 |
| Molecular Formula | C15H17F3N4O3 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-(1-cyclopropyl-5-oxopyrrolidin-3-yl)-3-[4-methoxy-6-(trifluoromethyl)-3-pyridinyl]urea |
| SMILES | COc1cc(C(F)(F)F)ncc1NC(=O)NC1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C15H17F3N4O3/c1-25-11-5-12(15(16,17)18)19-6-10(11)21-14(24)20-8-4-13(23)22(7-8)9-2-3-9/h5-6,8-9H,2-4,7H2,1H3,(H2,20,21,24) |
| InChIKey | SUOFQWOFVWHZOY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |