C20H29N3O3 — CID 25386143
1-[(3R)-1-cycloheptyl-5-oxopyrrolidin-3-yl]-3-(4-methoxy-2-methylphenyl)urea (PubChem CID 25386143) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[(3R)-1-cycloheptyl-5-oxopyrrolidin-3-yl]-3-(4-methoxy-2-methylphenyl)urea.
| Compound Name | 1-[(3R)-1-cycloheptyl-5-oxopyrrolidin-3-yl]-3-(4-methoxy-2-methylphenyl)urea |
|---|---|
| PubChem CID | 25386143 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-[(3R)-1-cycloheptyl-5-oxopyrrolidin-3-yl]-3-(4-methoxy-2-methylphenyl)urea |
| SMILES | COc1ccc(NC(=O)N[C@@H]2CC(=O)N(C3CCCCCC3)C2)c(C)c1 |
| InChI | InChI=1S/C20H29N3O3/c1-14-11-17(26-2)9-10-18(14)22-20(25)21-15-12-19(24)23(13-15)16-7-5-3-4-6-8-16/h9-11,15-16H,3-8,12-13H2,1-2H3,(H2,21,22,25)/t15-/m1/s1 |
| InChIKey | WHXJWSWUQWWBFW-OAHLLOKOSA-N |
| XLogP | 3.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |