C18H13F2N3O2 — CID 119050195
N-[2-[(2,2-difluoroacetyl)amino]phenyl]quinoline-2-carboxamide (PubChem CID 119050195) has the molecular formula C18H13F2N3O2 and a molecular weight of 341.32 g/mol. Its IUPAC name is N-[2-[(2,2-difluoroacetyl)amino]phenyl]quinoline-2-carboxamide.
| Compound Name | N-[2-[(2,2-difluoroacetyl)amino]phenyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 119050195 |
| Molecular Formula | C18H13F2N3O2 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[2-[(2,2-difluoroacetyl)amino]phenyl]quinoline-2-carboxamide |
| SMILES | O=C(Nc1ccccc1NC(=O)C(F)F)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H13F2N3O2/c19-16(20)18(25)23-14-8-4-3-7-13(14)22-17(24)15-10-9-11-5-1-2-6-12(11)21-15/h1-10,16H,(H,22,24)(H,23,25) |
| InChIKey | MRFKGFCWVYGKMQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |