C14H20FN3O2S — CID 119051485
N-(2-fluoroethyl)-2-[(4-methylsulfanylphenyl)methylcarbamoylamino]propanamide (PubChem CID 119051485) has the molecular formula C14H20FN3O2S and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2-[(4-methylsulfanylphenyl)methylcarbamoylamino]propanamide.
| Compound Name | N-(2-fluoroethyl)-2-[(4-methylsulfanylphenyl)methylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 119051485 |
| Molecular Formula | C14H20FN3O2S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-(2-fluoroethyl)-2-[(4-methylsulfanylphenyl)methylcarbamoylamino]propanamide |
| SMILES | CSc1ccc(CNC(=O)NC(C)C(=O)NCCF)cc1 |
| InChI | InChI=1S/C14H20FN3O2S/c1-10(13(19)16-8-7-15)18-14(20)17-9-11-3-5-12(21-2)6-4-11/h3-6,10H,7-9H2,1-2H3,(H,16,19)(H2,17,18,20) |
| InChIKey | BJZQVJRWRGLOJW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |