C17H28N4OS — CID 95759922
1-[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl]-3-[(4-methylsulfanylphenyl)methyl]urea (PubChem CID 95759922) has the molecular formula C17H28N4OS and a molecular weight of 336.50 g/mol. Its IUPAC name is 1-[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl]-3-[(4-methylsulfanylphenyl)methyl]urea.
| Compound Name | 1-[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl]-3-[(4-methylsulfanylphenyl)methyl]urea |
|---|---|
| PubChem CID | 95759922 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl]-3-[(4-methylsulfanylphenyl)methyl]urea |
| SMILES | CSc1ccc(CNC(=O)N[C@@H](C)CN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C17H28N4OS/c1-14(13-21-10-8-20(2)9-11-21)19-17(22)18-12-15-4-6-16(23-3)7-5-15/h4-7,14H,8-13H2,1-3H3,(H2,18,19,22)/t14-/m0/s1 |
| InChIKey | TYZBZUVTWBHPEW-AWEZNQCLSA-N |
| XLogP | 1.84 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |