C16H25ClN4O — CID 95313168
1-(3-chloro-4-methylphenyl)-3-[(2R)-1-(4-methylpiperazin-1-yl)propan-2-yl]urea (PubChem CID 95313168) has the molecular formula C16H25ClN4O and a molecular weight of 324.86 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[(2R)-1-(4-methylpiperazin-1-yl)propan-2-yl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[(2R)-1-(4-methylpiperazin-1-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 95313168 |
| Molecular Formula | C16H25ClN4O |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[(2R)-1-(4-methylpiperazin-1-yl)propan-2-yl]urea |
| SMILES | Cc1ccc(NC(=O)N[C@H](C)CN2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C16H25ClN4O/c1-12-4-5-14(10-15(12)17)19-16(22)18-13(2)11-21-8-6-20(3)7-9-21/h4-5,10,13H,6-9,11H2,1-3H3,(H2,18,19,22)/t13-/m1/s1 |
| InChIKey | GKROLXFRCUOUGX-CYBMUJFWSA-N |
| XLogP | 2.41 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |