C20H25ClN4O2 — CID 15541334
1-(3-chloro-4-methylphenyl)-3-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 15541334) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 15541334 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(C)c(Cl)c2)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-14-4-5-15(12-17(14)21)22-20(26)23-16-6-7-19(27-3)18(13-16)25-10-8-24(2)9-11-25/h4-7,12-13H,8-11H2,1-3H3,(H2,22,23,26) |
| InChIKey | XOGFKSPXDCJFBQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |