C15H13N3O4 — CID 119052110
methyl 2-[3-(1H-indazol-5-ylcarbamoyl)furan-2-yl]acetate (PubChem CID 119052110) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is methyl 2-[3-(1H-indazol-5-ylcarbamoyl)furan-2-yl]acetate.
| Compound Name | methyl 2-[3-(1H-indazol-5-ylcarbamoyl)furan-2-yl]acetate |
|---|---|
| PubChem CID | 119052110 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 2-[3-(1H-indazol-5-ylcarbamoyl)furan-2-yl]acetate |
| SMILES | COC(=O)Cc1occc1C(=O)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C15H13N3O4/c1-21-14(19)7-13-11(4-5-22-13)15(20)17-10-2-3-12-9(6-10)8-16-18-12/h2-6,8H,7H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | VYWRYCKJVKDJDN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |