C10H18N2O3 — CID 119055086
1-[1-(3-methoxypropyl)pyrazol-3-yl]propane-1,3-diol (PubChem CID 119055086) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-[1-(3-methoxypropyl)pyrazol-3-yl]propane-1,3-diol.
| Compound Name | 1-[1-(3-methoxypropyl)pyrazol-3-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 119055086 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-[1-(3-methoxypropyl)pyrazol-3-yl]propane-1,3-diol |
| SMILES | COCCCn1ccc(C(O)CCO)n1 |
| InChI | InChI=1S/C10H18N2O3/c1-15-8-2-5-12-6-3-9(11-12)10(14)4-7-13/h3,6,10,13-14H,2,4-5,7-8H2,1H3 |
| InChIKey | GSQHGUGVQBJVSQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|