C8H14N2O2 — CID 129418649
(1R)-1-(1-ethylpyrazol-3-yl)propane-1,3-diol (PubChem CID 129418649) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (1R)-1-(1-ethylpyrazol-3-yl)propane-1,3-diol.
| Compound Name | (1R)-1-(1-ethylpyrazol-3-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 129418649 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (1R)-1-(1-ethylpyrazol-3-yl)propane-1,3-diol |
| SMILES | CCn1ccc([C@H](O)CCO)n1 |
| InChI | InChI=1S/C8H14N2O2/c1-2-10-5-3-7(9-10)8(12)4-6-11/h3,5,8,11-12H,2,4,6H2,1H3/t8-/m1/s1 |
| InChIKey | UZSLZTNNAYJZTI-MRVPVSSYSA-N |
| XLogP | 0.32 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |