C17H17FN6O2 — CID 119055917
N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-(phenoxymethyl)pyrazole-3-carboxamide (PubChem CID 119055917) has the molecular formula C17H17FN6O2 and a molecular weight of 356.36 g/mol. Its IUPAC name is N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-(phenoxymethyl)pyrazole-3-carboxamide.
| Compound Name | N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-(phenoxymethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119055917 |
| Molecular Formula | C17H17FN6O2 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-(phenoxymethyl)pyrazole-3-carboxamide |
| SMILES | Cc1nn(C)c(F)c1/C=N/NC(=O)c1ccn(COc2ccccc2)n1 |
| InChI | InChI=1S/C17H17FN6O2/c1-12-14(16(18)23(2)21-12)10-19-20-17(25)15-8-9-24(22-15)11-26-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,20,25)/b19-10+ |
| InChIKey | FKEFXBZGHHBABY-VXLYETTFSA-N |
| XLogP | 1.86 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|