About 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate
2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate (PubChem CID 11905640) has the molecular formula C10H18NO5+
and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate |
| PubChem CID | 11905640 |
| Molecular Formula | C10H18NO5+ |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate |
| SMILES | COCCOC(=O)[C@H]1C[NH+]1[C@H](C)C(=O)OC |
| InChI | InChI=1S/C10H17NO5/c1-7(9(12)15-3)11-6-8(11)10(13)16-5-4-14-2/h7-8H,4-6H2,1-3H3/p+1/t7-,8-,11?/m1/s1 |
| InChIKey | WCTPTWXEZZFTIO-KQUALDNSSA-O |
| XLogP | -2.00 |
| TPSA | 66.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate?
The IUPAC name of 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate (CID 11905640) is 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate.
What is the SMILES notation for 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate?
The canonical SMILES for 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate is COCCOC(=O)[C@H]1C[NH+]1[C@H](C)C(=O)OC.
What is the InChIKey of 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate?
The InChIKey is WCTPTWXEZZFTIO-KQUALDNSSA-O. The full InChI is InChI=1S/C10H17NO5/c1-7(9(12)15-3)11-6-8(11)10(13)16-5-4-14-2/h7-8H,4-6H2,1-3H3/p+1/t7-,8-,11?/m1/s1.
What are the key properties of 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate?
2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate has a molecular weight of 232.26 g/mol, XLogP of -2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl (2R)-1-[(2R)-1-methoxy-1-oxopropan-2-yl]aziridin-1-ium-2-carboxylate is sourced from PubChem (CID 11905640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).