About 3-cyclohexylazetidine;hydrochloride
3-cyclohexylazetidine;hydrochloride (PubChem CID 119056954) has the molecular formula C9H18ClN
and a molecular weight of 175.70 g/mol. Its IUPAC name is 3-cyclohexylazetidine;hydrochloride.
Molecular Properties
| Compound Name | 3-cyclohexylazetidine;hydrochloride |
| PubChem CID | 119056954 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3-cyclohexylazetidine;hydrochloride |
| SMILES | C1CCC(C2CNC2)CC1.Cl |
| InChI | InChI=1S/C9H17N.ClH/c1-2-4-8(5-3-1)9-6-10-7-9;/h8-10H,1-7H2;1H |
| InChIKey | VBMNTOIZZFUXNZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexylazetidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylazetidine;hydrochloride?
The IUPAC name of 3-cyclohexylazetidine;hydrochloride (CID 119056954) is 3-cyclohexylazetidine;hydrochloride.
What is the SMILES notation for 3-cyclohexylazetidine;hydrochloride?
The canonical SMILES for 3-cyclohexylazetidine;hydrochloride is C1CCC(C2CNC2)CC1.Cl.
What is the InChIKey of 3-cyclohexylazetidine;hydrochloride?
The InChIKey is VBMNTOIZZFUXNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.ClH/c1-2-4-8(5-3-1)9-6-10-7-9;/h8-10H,1-7H2;1H.
What are the key properties of 3-cyclohexylazetidine;hydrochloride?
3-cyclohexylazetidine;hydrochloride has a molecular weight of 175.70 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylazetidine;hydrochloride is sourced from PubChem (CID 119056954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).