About 1-azaspiro[3.5]nonane;hydrochloride
1-azaspiro[3.5]nonane;hydrochloride (PubChem CID 54595633) has the molecular formula C8H16ClN
and a molecular weight of 161.68 g/mol. Its IUPAC name is 1-azaspiro[3.5]nonane;hydrochloride.
Molecular Properties
| Compound Name | 1-azaspiro[3.5]nonane;hydrochloride |
| PubChem CID | 54595633 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1-azaspiro[3.5]nonane;hydrochloride |
| SMILES | C1CCC2(CC1)CCN2.Cl |
| InChI | InChI=1S/C8H15N.ClH/c1-2-4-8(5-3-1)6-7-9-8;/h9H,1-7H2;1H |
| InChIKey | GPWATQMKTRHHTG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-azaspiro[3.5]nonane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[3.5]nonane;hydrochloride?
The IUPAC name of 1-azaspiro[3.5]nonane;hydrochloride (CID 54595633) is 1-azaspiro[3.5]nonane;hydrochloride.
What is the SMILES notation for 1-azaspiro[3.5]nonane;hydrochloride?
The canonical SMILES for 1-azaspiro[3.5]nonane;hydrochloride is C1CCC2(CC1)CCN2.Cl.
What is the InChIKey of 1-azaspiro[3.5]nonane;hydrochloride?
The InChIKey is GPWATQMKTRHHTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.ClH/c1-2-4-8(5-3-1)6-7-9-8;/h9H,1-7H2;1H.
What are the key properties of 1-azaspiro[3.5]nonane;hydrochloride?
1-azaspiro[3.5]nonane;hydrochloride has a molecular weight of 161.68 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[3.5]nonane;hydrochloride is sourced from PubChem (CID 54595633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).