C21H18Cl2FN5OS — CID 119057315
3-(2,6-dichloro-3-fluorophenyl)sulfinyl-5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 119057315) has the molecular formula C21H18Cl2FN5OS and a molecular weight of 478.38 g/mol. Its IUPAC name is 3-(2,6-dichloro-3-fluorophenyl)sulfinyl-5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(2,6-dichloro-3-fluorophenyl)sulfinyl-5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 119057315 |
| Molecular Formula | C21H18Cl2FN5OS |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 3-(2,6-dichloro-3-fluorophenyl)sulfinyl-5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=S(c1c(Cl)ccc(F)c1Cl)c1c[nH]c2ncc(-c3cnn(C4CCNCC4)c3)cc12 |
| InChI | InChI=1S/C21H18Cl2FN5OS/c22-16-1-2-17(24)19(23)20(16)31(30)18-10-27-21-15(18)7-12(8-26-21)13-9-28-29(11-13)14-3-5-25-6-4-14/h1-2,7-11,14,25H,3-6H2,(H,26,27) |
| InChIKey | LEHQHFLLRYUONA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|