C14H29N6O6+ — CID 119058128
[(4S)-4-[[2-[[(2S)-2-amino-4-carboxybutanoyl]amino]acetyl]amino]-5,5-dihydroxyhexyl]-(diaminomethylidene)azanium (PubChem CID 119058128) has the molecular formula C14H29N6O6+ and a molecular weight of 377.42 g/mol. Its IUPAC name is [(4S)-4-[[2-[[(2S)-2-amino-4-carboxybutanoyl]amino]acetyl]amino]-5,5-dihydroxyhexyl]-(diaminomethylidene)azanium.
| Compound Name | [(4S)-4-[[2-[[(2S)-2-amino-4-carboxybutanoyl]amino]acetyl]amino]-5,5-dihydroxyhexyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 119058128 |
| Molecular Formula | C14H29N6O6+ |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | [(4S)-4-[[2-[[(2S)-2-amino-4-carboxybutanoyl]amino]acetyl]amino]-5,5-dihydroxyhexyl]-(diaminomethylidene)azanium |
| SMILES | CC(O)(O)[C@H](CCC[NH+]=C(N)N)NC(=O)CNC(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C14H28N6O6/c1-14(25,26)9(3-2-6-18-13(16)17)20-10(21)7-19-12(24)8(15)4-5-11(22)23/h8-9,25-26H,2-7,15H2,1H3,(H,19,24)(H,20,21)(H,22,23)(H4,16,17,18)/p+1/t8-,9-/m0/s1 |
| InChIKey | IMLNCWNFZBCWOL-IUCAKERBSA-O |
| XLogP | -5.39 |
| TPSA | 227.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | -5.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|