C26H40N7O8S+ — CID 5326434
[(4S)-4-[[2-[[(2S)-4-carboxy-2-[[5-(dimethylamino)naphthalen-2-yl]sulfonylamino]butanoyl]amino]acetyl]amino]-5,5-dihydroxyhexyl]-(diaminomethylidene)azanium (PubChem CID 5326434) has the molecular formula C26H40N7O8S+ and a molecular weight of 610.71 g/mol. Its IUPAC name is [(4S)-4-[[2-[[(2S)-4-carboxy-2-[[5-(dimethylamino)naphthalen-2-yl]sulfonylamino]butanoyl]amino]acetyl]amino]-5,5-dihydroxyhexyl]-(diaminomethylidene)azanium.
| Compound Name | [(4S)-4-[[2-[[(2S)-4-carboxy-2-[[5-(dimethylamino)naphthalen-2-yl]sulfonylamino]butanoyl]amino]acetyl]amino]-5,5-dihydroxyhexyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 5326434 |
| Molecular Formula | C26H40N7O8S+ |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | [(4S)-4-[[2-[[(2S)-4-carboxy-2-[[5-(dimethylamino)naphthalen-2-yl]sulfonylamino]butanoyl]amino]acetyl]amino]-5,5-dihydroxyhexyl]-(diaminomethylidene)azanium |
| SMILES | CN(C)c1cccc2cc(S(=O)(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)N[C@@H](CCC[NH+]=C(N)N)C(C)(O)O)ccc12 |
| InChI | InChI=1S/C26H39N7O8S/c1-26(38,39)21(8-5-13-29-25(27)28)31-22(34)15-30-24(37)19(11-12-23(35)36)32-42(40,41)17-9-10-18-16(14-17)6-4-7-20(18)33(2)3/h4,6-7,9-10,14,19,21,32,38-39H,5,8,11-13,15H2,1-3H3,(H,30,37)(H,31,34)(H,35,36)(H4,27,28,29)/p+1/t19-,21-/m0/s1 |
| InChIKey | WROSHUHGBOAOGA-FPOVZHCZSA-O |
| XLogP | -3.15 |
| TPSA | 251.38 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|