C26H34N6O6S — CID 67761157
[(2R)-1-[(2S)-2-[[5-(dimethylamino)naphthalen-2-yl]sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]piperidin-2-yl] hydrogen carbonate (PubChem CID 67761157) has the molecular formula C26H34N6O6S and a molecular weight of 558.66 g/mol. Its IUPAC name is [(2R)-1-[(2S)-2-[[5-(dimethylamino)naphthalen-2-yl]sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]piperidin-2-yl] hydrogen carbonate.
| Compound Name | [(2R)-1-[(2S)-2-[[5-(dimethylamino)naphthalen-2-yl]sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]piperidin-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67761157 |
| Molecular Formula | C26H34N6O6S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | [(2R)-1-[(2S)-2-[[5-(dimethylamino)naphthalen-2-yl]sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]piperidin-2-yl] hydrogen carbonate |
| SMILES | CN(C)c1cccc2cc(S(=O)(=O)N[C@@H](CCCNc3ncc[nH]3)C(=O)N3CCCC[C@H]3OC(=O)O)ccc12 |
| InChI | InChI=1S/C26H34N6O6S/c1-31(2)22-9-5-7-18-17-19(11-12-20(18)22)39(36,37)30-21(8-6-13-27-25-28-14-15-29-25)24(33)32-16-4-3-10-23(32)38-26(34)35/h5,7,9,11-12,14-15,17,21,23,30H,3-4,6,8,10,13,16H2,1-2H3,(H,34,35)(H2,27,28,29)/t21-,23+/m0/s1 |
| InChIKey | VHVPEIFTQPRXQP-JTHBVZDNSA-N |
| XLogP | 3.20 |
| TPSA | 156.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|