C19H25N3O5S — CID 69096166
[1-[2-(1H-indol-4-ylsulfonylamino)butanoyl]piperidin-2-yl] acetate (PubChem CID 69096166) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is [1-[2-(1H-indol-4-ylsulfonylamino)butanoyl]piperidin-2-yl] acetate.
| Compound Name | [1-[2-(1H-indol-4-ylsulfonylamino)butanoyl]piperidin-2-yl] acetate |
|---|---|
| PubChem CID | 69096166 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [1-[2-(1H-indol-4-ylsulfonylamino)butanoyl]piperidin-2-yl] acetate |
| SMILES | CCC(NS(=O)(=O)c1cccc2[nH]ccc12)C(=O)N1CCCCC1OC(C)=O |
| InChI | InChI=1S/C19H25N3O5S/c1-3-15(19(24)22-12-5-4-9-18(22)27-13(2)23)21-28(25,26)17-8-6-7-16-14(17)10-11-20-16/h6-8,10-11,15,18,20-21H,3-5,9,12H2,1-2H3 |
| InChIKey | JELSLJHGKRGQRD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |