C26H29N5O5S — CID 76807879
methyl 3-[1-[4-(2-cyanopyrrol-1-yl)-2-(1H-indol-4-ylsulfonylamino)butanoyl]piperidin-3-yl]prop-2-enoate (PubChem CID 76807879) has the molecular formula C26H29N5O5S and a molecular weight of 523.62 g/mol. Its IUPAC name is methyl 3-[1-[4-(2-cyanopyrrol-1-yl)-2-(1H-indol-4-ylsulfonylamino)butanoyl]piperidin-3-yl]prop-2-enoate.
| Compound Name | methyl 3-[1-[4-(2-cyanopyrrol-1-yl)-2-(1H-indol-4-ylsulfonylamino)butanoyl]piperidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 76807879 |
| Molecular Formula | C26H29N5O5S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | methyl 3-[1-[4-(2-cyanopyrrol-1-yl)-2-(1H-indol-4-ylsulfonylamino)butanoyl]piperidin-3-yl]prop-2-enoate |
| SMILES | COC(=O)C=CC1CCCN(C(=O)C(CCn2cccc2C#N)NS(=O)(=O)c2cccc3[nH]ccc23)C1 |
| InChI | InChI=1S/C26H29N5O5S/c1-36-25(32)10-9-19-5-3-15-31(18-19)26(33)23(12-16-30-14-4-6-20(30)17-27)29-37(34,35)24-8-2-7-22-21(24)11-13-28-22/h2,4,6-11,13-14,19,23,28-29H,3,5,12,15-16,18H2,1H3 |
| InChIKey | RVULASWTBXJQLS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|