C22H25N5O2S — CID 143877375
1-[4-(3-hydroxypiperidin-1-yl)-3-(1H-indol-4-ylsulfanylamino)-4-oxobutyl]pyrrole-2-carbonitrile (PubChem CID 143877375) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 1-[4-(3-hydroxypiperidin-1-yl)-3-(1H-indol-4-ylsulfanylamino)-4-oxobutyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[4-(3-hydroxypiperidin-1-yl)-3-(1H-indol-4-ylsulfanylamino)-4-oxobutyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 143877375 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[4-(3-hydroxypiperidin-1-yl)-3-(1H-indol-4-ylsulfanylamino)-4-oxobutyl]pyrrole-2-carbonitrile |
| SMILES | N#Cc1cccn1CCC(NSc1cccc2[nH]ccc12)C(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C22H25N5O2S/c23-14-16-4-2-11-26(16)13-9-20(22(29)27-12-3-5-17(28)15-27)25-30-21-7-1-6-19-18(21)8-10-24-19/h1-2,4,6-8,10-11,17,20,24-25,28H,3,5,9,12-13,15H2 |
| InChIKey | GTHWVYKWQAUNIE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|