C21H25Cl2N5OS — CID 143877407
1-[3-[(4-amino-3,5-dichlorophenyl)sulfanylamino]-4-(azepan-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile (PubChem CID 143877407) has the molecular formula C21H25Cl2N5OS and a molecular weight of 466.44 g/mol. Its IUPAC name is 1-[3-[(4-amino-3,5-dichlorophenyl)sulfanylamino]-4-(azepan-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[3-[(4-amino-3,5-dichlorophenyl)sulfanylamino]-4-(azepan-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 143877407 |
| Molecular Formula | C21H25Cl2N5OS |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 1-[3-[(4-amino-3,5-dichlorophenyl)sulfanylamino]-4-(azepan-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile |
| SMILES | N#Cc1cccn1CCC(NSc1cc(Cl)c(N)c(Cl)c1)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C21H25Cl2N5OS/c22-17-12-16(13-18(23)20(17)25)30-26-19(7-11-27-10-5-6-15(27)14-24)21(29)28-8-3-1-2-4-9-28/h5-6,10,12-13,19,26H,1-4,7-9,11,25H2 |
| InChIKey | YEMRKXGOCWSWRE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|