C21H25BrN4OS — CID 143877594
1-[3-[(2-bromophenyl)sulfanylamino]-4-(4-methylpiperidin-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile (PubChem CID 143877594) has the molecular formula C21H25BrN4OS and a molecular weight of 461.43 g/mol. Its IUPAC name is 1-[3-[(2-bromophenyl)sulfanylamino]-4-(4-methylpiperidin-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[3-[(2-bromophenyl)sulfanylamino]-4-(4-methylpiperidin-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 143877594 |
| Molecular Formula | C21H25BrN4OS |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 1-[3-[(2-bromophenyl)sulfanylamino]-4-(4-methylpiperidin-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile |
| SMILES | CC1CCN(C(=O)C(CCn2cccc2C#N)NSc2ccccc2Br)CC1 |
| InChI | InChI=1S/C21H25BrN4OS/c1-16-8-12-26(13-9-16)21(27)19(10-14-25-11-4-5-17(25)15-23)24-28-20-7-3-2-6-18(20)22/h2-7,11,16,19,24H,8-10,12-14H2,1H3 |
| InChIKey | YPMYTFQAEAHSJO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|