C22H26N6OS — CID 143877386
1-[3-(1H-indazol-4-ylsulfanylamino)-4-(4-methylpiperidin-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile (PubChem CID 143877386) has the molecular formula C22H26N6OS and a molecular weight of 422.56 g/mol. Its IUPAC name is 1-[3-(1H-indazol-4-ylsulfanylamino)-4-(4-methylpiperidin-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[3-(1H-indazol-4-ylsulfanylamino)-4-(4-methylpiperidin-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 143877386 |
| Molecular Formula | C22H26N6OS |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-[3-(1H-indazol-4-ylsulfanylamino)-4-(4-methylpiperidin-1-yl)-4-oxobutyl]pyrrole-2-carbonitrile |
| SMILES | CC1CCN(C(=O)C(CCn2cccc2C#N)NSc2cccc3[nH]ncc23)CC1 |
| InChI | InChI=1S/C22H26N6OS/c1-16-7-11-28(12-8-16)22(29)20(9-13-27-10-3-4-17(27)14-23)26-30-21-6-2-5-19-18(21)15-24-25-19/h2-6,10,15-16,20,26H,7-9,11-13H2,1H3,(H,24,25) |
| InChIKey | ZZRWJCXGMQKWIC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|