C23H26N4OS — CID 66884791
1-[4-(4-methylpiperidin-1-yl)-4-oxo-3-(4-sulfanylindol-1-yl)butyl]pyrrole-2-carbonitrile (PubChem CID 66884791) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is 1-[4-(4-methylpiperidin-1-yl)-4-oxo-3-(4-sulfanylindol-1-yl)butyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[4-(4-methylpiperidin-1-yl)-4-oxo-3-(4-sulfanylindol-1-yl)butyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 66884791 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-[4-(4-methylpiperidin-1-yl)-4-oxo-3-(4-sulfanylindol-1-yl)butyl]pyrrole-2-carbonitrile |
| SMILES | CC1CCN(C(=O)C(CCn2cccc2C#N)n2ccc3c(S)cccc32)CC1 |
| InChI | InChI=1S/C23H26N4OS/c1-17-7-12-26(13-8-17)23(28)21(10-14-25-11-3-4-18(25)16-24)27-15-9-19-20(27)5-2-6-22(19)29/h2-6,9,11,15,17,21,29H,7-8,10,12-14H2,1H3 |
| InChIKey | GNXPAYWZAIAMOF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|