C24H28ClN3O3S — CID 90329296
1-[4-(2-chlorophenyl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]indole-4-sulfonamide (PubChem CID 90329296) has the molecular formula C24H28ClN3O3S and a molecular weight of 474.03 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]indole-4-sulfonamide.
| Compound Name | 1-[4-(2-chlorophenyl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]indole-4-sulfonamide |
|---|---|
| PubChem CID | 90329296 |
| Molecular Formula | C24H28ClN3O3S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 1-[4-(2-chlorophenyl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]indole-4-sulfonamide |
| SMILES | CC1CCN(C(=O)C(CCc2ccccc2Cl)n2ccc3c(S(N)(=O)=O)cccc32)CC1 |
| InChI | InChI=1S/C24H28ClN3O3S/c1-17-11-14-27(15-12-17)24(29)22(10-9-18-5-2-3-6-20(18)25)28-16-13-19-21(28)7-4-8-23(19)32(26,30)31/h2-8,13,16-17,22H,9-12,14-15H2,1H3,(H2,26,30,31) |
| InChIKey | DUBJWHLJJYYVDY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |