C22H28Cl2N2OS — CID 143898293
4-(2-chlorophenyl)-2-(3-chlorophenyl)-1-(4-methylpiperidin-1-yl)butan-1-one;thiohydroxylamine (PubChem CID 143898293) has the molecular formula C22H28Cl2N2OS and a molecular weight of 439.45 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2-(3-chlorophenyl)-1-(4-methylpiperidin-1-yl)butan-1-one;thiohydroxylamine.
| Compound Name | 4-(2-chlorophenyl)-2-(3-chlorophenyl)-1-(4-methylpiperidin-1-yl)butan-1-one;thiohydroxylamine |
|---|---|
| PubChem CID | 143898293 |
| Molecular Formula | C22H28Cl2N2OS |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 4-(2-chlorophenyl)-2-(3-chlorophenyl)-1-(4-methylpiperidin-1-yl)butan-1-one;thiohydroxylamine |
| SMILES | CC1CCN(C(=O)C(CCc2ccccc2Cl)c2cccc(Cl)c2)CC1.NS |
| InChI | InChI=1S/C22H25Cl2NO.H3NS/c1-16-11-13-25(14-12-16)22(26)20(18-6-4-7-19(23)15-18)10-9-17-5-2-3-8-21(17)24;1-2/h2-8,15-16,20H,9-14H2,1H3;2H,1H2 |
| InChIKey | PYWMQNZPOAJWQM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|