C18H29ClN2O — CID 143898395
2-amino-4-(2-chlorophenyl)-1-(4-methylpiperidin-1-yl)butan-1-one;ethane (PubChem CID 143898395) has the molecular formula C18H29ClN2O and a molecular weight of 324.90 g/mol. Its IUPAC name is 2-amino-4-(2-chlorophenyl)-1-(4-methylpiperidin-1-yl)butan-1-one;ethane.
| Compound Name | 2-amino-4-(2-chlorophenyl)-1-(4-methylpiperidin-1-yl)butan-1-one;ethane |
|---|---|
| PubChem CID | 143898395 |
| Molecular Formula | C18H29ClN2O |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 2-amino-4-(2-chlorophenyl)-1-(4-methylpiperidin-1-yl)butan-1-one;ethane |
| SMILES | CC.CC1CCN(C(=O)C(N)CCc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H23ClN2O.C2H6/c1-12-8-10-19(11-9-12)16(20)15(18)7-6-13-4-2-3-5-14(13)17;1-2/h2-5,12,15H,6-11,18H2,1H3;1-2H3 |
| InChIKey | ACPVZIYPJUFIAW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |