C24H30N4O4S — CID 143877374
methyl 3-[[4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]amino]sulfanyl-4-methoxybenzoate (PubChem CID 143877374) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is methyl 3-[[4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]amino]sulfanyl-4-methoxybenzoate.
| Compound Name | methyl 3-[[4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]amino]sulfanyl-4-methoxybenzoate |
|---|---|
| PubChem CID | 143877374 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | methyl 3-[[4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]amino]sulfanyl-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(SNC(CCn2cccc2C#N)C(=O)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C24H30N4O4S/c1-17-8-12-28(13-9-17)23(29)20(10-14-27-11-4-5-19(27)16-25)26-33-22-15-18(24(30)32-3)6-7-21(22)31-2/h4-7,11,15,17,20,26H,8-10,12-14H2,1-3H3 |
| InChIKey | JFFXTGHZZINRHY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|