C19H24Cl3N5OS — CID 143877504
2-[(4-amino-3,5-dichlorophenyl)sulfanylamino]-4-(2-chloroimidazol-1-yl)-1-(4-methylpiperidin-1-yl)butan-1-one (PubChem CID 143877504) has the molecular formula C19H24Cl3N5OS and a molecular weight of 476.86 g/mol. Its IUPAC name is 2-[(4-amino-3,5-dichlorophenyl)sulfanylamino]-4-(2-chloroimidazol-1-yl)-1-(4-methylpiperidin-1-yl)butan-1-one.
| Compound Name | 2-[(4-amino-3,5-dichlorophenyl)sulfanylamino]-4-(2-chloroimidazol-1-yl)-1-(4-methylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 143877504 |
| Molecular Formula | C19H24Cl3N5OS |
| Molecular Weight | 476.86 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 2-[(4-amino-3,5-dichlorophenyl)sulfanylamino]-4-(2-chloroimidazol-1-yl)-1-(4-methylpiperidin-1-yl)butan-1-one |
| SMILES | CC1CCN(C(=O)C(CCn2ccnc2Cl)NSc2cc(Cl)c(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H24Cl3N5OS/c1-12-2-6-26(7-3-12)18(28)16(4-8-27-9-5-24-19(27)22)25-29-13-10-14(20)17(23)15(21)11-13/h5,9-12,16,25H,2-4,6-8,23H2,1H3 |
| InChIKey | BDRPEAXIRFVAFJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.86 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|