C18H24Cl2N6O3S — CID 134147604
4-amino-3,5-dichloro-N-[1-(4-methylpiperidin-1-yl)-1-oxo-4-(triazol-1-yl)butan-2-yl]benzenesulfonamide (PubChem CID 134147604) has the molecular formula C18H24Cl2N6O3S and a molecular weight of 475.40 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[1-(4-methylpiperidin-1-yl)-1-oxo-4-(triazol-1-yl)butan-2-yl]benzenesulfonamide.
| Compound Name | 4-amino-3,5-dichloro-N-[1-(4-methylpiperidin-1-yl)-1-oxo-4-(triazol-1-yl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134147604 |
| Molecular Formula | C18H24Cl2N6O3S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[1-(4-methylpiperidin-1-yl)-1-oxo-4-(triazol-1-yl)butan-2-yl]benzenesulfonamide |
| SMILES | CC1CCN(C(=O)C(CCn2ccnn2)NS(=O)(=O)c2cc(Cl)c(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H24Cl2N6O3S/c1-12-2-6-25(7-3-12)18(27)16(4-8-26-9-5-22-24-26)23-30(28,29)13-10-14(19)17(21)15(20)11-13/h5,9-12,16,23H,2-4,6-8,21H2,1H3 |
| InChIKey | JIGFQRQBGRUWAJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|