C21H25Cl3N4O3S — CID 58504916
4-amino-3,5-dichloro-N-[3-(3-chloroanilino)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]benzenesulfonamide (PubChem CID 58504916) has the molecular formula C21H25Cl3N4O3S and a molecular weight of 519.88 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[3-(3-chloroanilino)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]benzenesulfonamide.
| Compound Name | 4-amino-3,5-dichloro-N-[3-(3-chloroanilino)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 58504916 |
| Molecular Formula | C21H25Cl3N4O3S |
| Molecular Weight | 519.88 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[3-(3-chloroanilino)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]benzenesulfonamide |
| SMILES | CC1CCN(C(=O)C(CNc2cccc(Cl)c2)NS(=O)(=O)c2cc(Cl)c(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C21H25Cl3N4O3S/c1-13-5-7-28(8-6-13)21(29)19(12-26-15-4-2-3-14(22)9-15)27-32(30,31)16-10-17(23)20(25)18(24)11-16/h2-4,9-11,13,19,26-27H,5-8,12,25H2,1H3 |
| InChIKey | KZIRBHUHMNKGSB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|