C19H26Cl2N6O3S — CID 89143030
4-amino-N-[4-(5-aminopyrazol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-3,5-dichlorobenzenesulfonamide (PubChem CID 89143030) has the molecular formula C19H26Cl2N6O3S and a molecular weight of 489.43 g/mol. Its IUPAC name is 4-amino-N-[4-(5-aminopyrazol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-3,5-dichlorobenzenesulfonamide.
| Compound Name | 4-amino-N-[4-(5-aminopyrazol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 89143030 |
| Molecular Formula | C19H26Cl2N6O3S |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 4-amino-N-[4-(5-aminopyrazol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-3,5-dichlorobenzenesulfonamide |
| SMILES | CC1CCN(C(=O)C(CCn2nccc2N)NS(=O)(=O)c2cc(Cl)c(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H26Cl2N6O3S/c1-12-3-7-26(8-4-12)19(28)16(5-9-27-17(22)2-6-24-27)25-31(29,30)13-10-14(20)18(23)15(21)11-13/h2,6,10-12,16,25H,3-5,7-9,22-23H2,1H3 |
| InChIKey | VGSYXOWTRZEFAT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|