C21H27N5O2 — CID 119058607
3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[(8-methoxyquinolin-5-yl)methyl]-1-methylurea (PubChem CID 119058607) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[(8-methoxyquinolin-5-yl)methyl]-1-methylurea.
| Compound Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[(8-methoxyquinolin-5-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 119058607 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-[(8-methoxyquinolin-5-yl)methyl]-1-methylurea |
| SMILES | COc1ccc(CN(C)C(=O)NCCCn2nc(C)cc2C)c2cccnc12 |
| InChI | InChI=1S/C21H27N5O2/c1-15-13-16(2)26(24-15)12-6-11-23-21(27)25(3)14-17-8-9-19(28-4)20-18(17)7-5-10-22-20/h5,7-10,13H,6,11-12,14H2,1-4H3,(H,23,27) |
| InChIKey | PBOLOLQOGUMFPC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|