C20H24N6O2 — CID 119059323
5-ethyl-N-[(1-phenyltetrazol-5-yl)methyl]-4-(pyrrolidin-1-ylmethyl)furan-2-carboxamide (PubChem CID 119059323) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 5-ethyl-N-[(1-phenyltetrazol-5-yl)methyl]-4-(pyrrolidin-1-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-ethyl-N-[(1-phenyltetrazol-5-yl)methyl]-4-(pyrrolidin-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 119059323 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-ethyl-N-[(1-phenyltetrazol-5-yl)methyl]-4-(pyrrolidin-1-ylmethyl)furan-2-carboxamide |
| SMILES | CCc1oc(C(=O)NCc2nnnn2-c2ccccc2)cc1CN1CCCC1 |
| InChI | InChI=1S/C20H24N6O2/c1-2-17-15(14-25-10-6-7-11-25)12-18(28-17)20(27)21-13-19-22-23-24-26(19)16-8-4-3-5-9-16/h3-5,8-9,12H,2,6-7,10-11,13-14H2,1H3,(H,21,27) |
| InChIKey | KSZQRMRFPWWPMS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |