C17H25N5O2 — CID 119074223
5-ethyl-4-(pyrrolidin-1-ylmethyl)-N-[3-(triazol-1-yl)propyl]furan-2-carboxamide (PubChem CID 119074223) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-ethyl-4-(pyrrolidin-1-ylmethyl)-N-[3-(triazol-1-yl)propyl]furan-2-carboxamide.
| Compound Name | 5-ethyl-4-(pyrrolidin-1-ylmethyl)-N-[3-(triazol-1-yl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119074223 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 5-ethyl-4-(pyrrolidin-1-ylmethyl)-N-[3-(triazol-1-yl)propyl]furan-2-carboxamide |
| SMILES | CCc1oc(C(=O)NCCCn2ccnn2)cc1CN1CCCC1 |
| InChI | InChI=1S/C17H25N5O2/c1-2-15-14(13-21-8-3-4-9-21)12-16(24-15)17(23)18-6-5-10-22-11-7-19-20-22/h7,11-12H,2-6,8-10,13H2,1H3,(H,18,23) |
| InChIKey | DRTYDPJCZXPUTC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|